C20H25N3O3S2 — CID 2421734
3-(4-morpholin-4-ylsulfonylphenyl)-1-phenyl-1-propan-2-ylthiourea (PubChem CID 2421734) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylsulfonylphenyl)-1-phenyl-1-propan-2-ylthiourea.
| Compound Name | 3-(4-morpholin-4-ylsulfonylphenyl)-1-phenyl-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 2421734 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-(4-morpholin-4-ylsulfonylphenyl)-1-phenyl-1-propan-2-ylthiourea |
| SMILES | CC(C)N(C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-16(2)23(18-6-4-3-5-7-18)20(27)21-17-8-10-19(11-9-17)28(24,25)22-12-14-26-15-13-22/h3-11,16H,12-15H2,1-2H3,(H,21,27) |
| InChIKey | JHNPKKWCYKZJRL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|