C26H29N3O3S2 — CID 3601294
1-(3,3-diphenylpropyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 3601294) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 3601294 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)NCCC(c2ccccc2)c2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H29N3O3S2/c30-34(31,29-17-19-32-20-18-29)24-13-11-23(12-14-24)28-26(33)27-16-15-25(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,25H,15-20H2,(H2,27,28,33) |
| InChIKey | ZXDSCOUTHNCCEH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|