C19H23N3O3S2 — CID 23880704
1-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea (PubChem CID 23880704) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 1-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea.
| Compound Name | 1-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea |
|---|---|
| PubChem CID | 23880704 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-ethyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea |
| SMILES | CCN(C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-2-22(17-6-4-3-5-7-17)19(26)20-16-8-10-18(11-9-16)27(23,24)21-12-14-25-15-13-21/h3-11H,2,12-15H2,1H3,(H,20,26) |
| InChIKey | QLHZUEFCXDNVDY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|