C18H21N3O3S2 — CID 23940437
1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea (PubChem CID 23940437) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea.
| Compound Name | 1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea |
|---|---|
| PubChem CID | 23940437 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-methyl-3-(4-morpholin-4-ylsulfonylphenyl)-1-phenylthiourea |
| SMILES | CN(C(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-20(16-5-3-2-4-6-16)18(25)19-15-7-9-17(10-8-15)26(22,23)21-11-13-24-14-12-21/h2-10H,11-14H2,1H3,(H,19,25) |
| InChIKey | WZJUWWUEMULULS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|