C13H19N3O2S — CID 3868005
4-acetyl-N-(furan-2-ylmethyl)-1,4-diazepane-1-carbothioamide (PubChem CID 3868005) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-acetyl-N-(furan-2-ylmethyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-acetyl-N-(furan-2-ylmethyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3868005 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-acetyl-N-(furan-2-ylmethyl)-1,4-diazepane-1-carbothioamide |
| SMILES | CC(=O)N1CCCN(C(=S)NCc2ccco2)CC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-11(17)15-5-3-6-16(8-7-15)13(19)14-10-12-4-2-9-18-12/h2,4,9H,3,5-8,10H2,1H3,(H,14,19) |
| InChIKey | XAILAAWDIVSGIT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|