C20H28N3O3S+ — CID 9098056
4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 9098056) has the molecular formula C20H28N3O3S+ and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9098056 |
| Molecular Formula | C20H28N3O3S+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-[(4,5-dimethoxy-2-methylphenyl)methyl]-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | COc1cc(C)c(C[NH+]2CCN(C(=S)NCc3ccco3)CC2)cc1OC |
| InChI | InChI=1S/C20H27N3O3S/c1-15-11-18(24-2)19(25-3)12-16(15)14-22-6-8-23(9-7-22)20(27)21-13-17-5-4-10-26-17/h4-5,10-12H,6-9,13-14H2,1-3H3,(H,21,27)/p+1 |
| InChIKey | NWDCAWGOPLOQFE-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 51.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|