C19H24N3O2S+ — CID 8500172
4-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide (PubChem CID 8500172) has the molecular formula C19H24N3O2S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8500172 |
| Molecular Formula | C19H24N3O2S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(furan-2-ylmethyl)piperazin-4-ium-1-carbothioamide |
| SMILES | S=C(NCc1ccco1)N1CC[NH+](Cc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c25-19(20-13-17-2-1-10-23-17)22-8-6-21(7-9-22)14-15-3-4-18-16(12-15)5-11-24-18/h1-4,10,12H,5-9,11,13-14H2,(H,20,25)/p+1 |
| InChIKey | HGUQJYPNSXXHSL-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 42.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|