C26H35N3O5S — CID 23853960
N-(furan-2-ylmethyl)-4-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-1-carbothioamide (PubChem CID 23853960) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-1-carbothioamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 23853960 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]piperidine-1-carbothioamide |
| SMILES | COc1cc(C(=O)N2CCC(C3CCN(C(=S)NCc4ccco4)CC3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C26H35N3O5S/c1-31-22-15-20(16-23(32-2)24(22)33-3)25(30)28-10-6-18(7-11-28)19-8-12-29(13-9-19)26(35)27-17-21-5-4-14-34-21/h4-5,14-16,18-19H,6-13,17H2,1-3H3,(H,27,35) |
| InChIKey | SQBAGFZKFUDDGH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|