C18H20ClN3O4S — CID 3445334
2-(3-chloro-2,6-dimethoxybenzoyl)-N-(furan-2-ylmethyl)pyrazolidine-1-carbothioamide (PubChem CID 3445334) has the molecular formula C18H20ClN3O4S and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-(3-chloro-2,6-dimethoxybenzoyl)-N-(furan-2-ylmethyl)pyrazolidine-1-carbothioamide.
| Compound Name | 2-(3-chloro-2,6-dimethoxybenzoyl)-N-(furan-2-ylmethyl)pyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3445334 |
| Molecular Formula | C18H20ClN3O4S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-(3-chloro-2,6-dimethoxybenzoyl)-N-(furan-2-ylmethyl)pyrazolidine-1-carbothioamide |
| SMILES | COc1ccc(Cl)c(OC)c1C(=O)N1CCCN1C(=S)NCc1ccco1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-24-14-7-6-13(19)16(25-2)15(14)17(23)21-8-4-9-22(21)18(27)20-11-12-5-3-10-26-12/h3,5-7,10H,4,8-9,11H2,1-2H3,(H,20,27) |
| InChIKey | DCSRZUFYTHYOLA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|