C14H10F4N2O3S — CID 17100625
2,3,5,6-tetrafluoro-N-(furan-2-ylmethylcarbamothioyl)-4-methoxybenzamide (PubChem CID 17100625) has the molecular formula C14H10F4N2O3S and a molecular weight of 362.30 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(furan-2-ylmethylcarbamothioyl)-4-methoxybenzamide.
| Compound Name | 2,3,5,6-tetrafluoro-N-(furan-2-ylmethylcarbamothioyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 17100625 |
| Molecular Formula | C14H10F4N2O3S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(furan-2-ylmethylcarbamothioyl)-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)NCc2ccco2)c(F)c1F |
| InChI | InChI=1S/C14H10F4N2O3S/c1-22-12-10(17)8(15)7(9(16)11(12)18)13(21)20-14(24)19-5-6-3-2-4-23-6/h2-4H,5H2,1H3,(H2,19,20,21,24) |
| InChIKey | VCECZNOCHWMLRF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|