C20H33N3O3S2 — CID 46800368
N-(3-ethoxypropyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 46800368) has the molecular formula C20H33N3O3S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(3-ethoxypropyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 46800368 |
| Molecular Formula | C20H33N3O3S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-(3-ethoxypropyl)-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCOCCCNC(=S)N1CCN(S(=O)(=O)c2c(C)c(C)cc(C)c2C)CC1 |
| InChI | InChI=1S/C20H33N3O3S2/c1-6-26-13-7-8-21-20(27)22-9-11-23(12-10-22)28(24,25)19-17(4)15(2)14-16(3)18(19)5/h14H,6-13H2,1-5H3,(H,21,27) |
| InChIKey | WDPIVYLOVMYKNE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|