C21H34N2O4S — CID 39271680
3-(2-methylpropoxy)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 39271680) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 3-(2-methylpropoxy)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 39271680 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 3-(2-methylpropoxy)-1-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)CCOCC(C)C)CC2)c1C |
| InChI | InChI=1S/C21H34N2O4S/c1-15(2)14-27-12-7-20(24)22-8-10-23(11-9-22)28(25,26)21-18(5)16(3)13-17(4)19(21)6/h13,15H,7-12,14H2,1-6H3 |
| InChIKey | AZGUAZSBSGYLQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|