C23H34N4O5S — CID 38073079
5,5-dimethyl-3-[4-oxo-4-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]butyl]imidazolidine-2,4-dione (PubChem CID 38073079) has the molecular formula C23H34N4O5S and a molecular weight of 478.62 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-oxo-4-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]butyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[4-oxo-4-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 38073079 |
| Molecular Formula | C23H34N4O5S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 5,5-dimethyl-3-[4-oxo-4-[4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazin-1-yl]butyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(C(=O)CCCN3C(=O)NC(C)(C)C3=O)CC2)c1C |
| InChI | InChI=1S/C23H34N4O5S/c1-15-14-16(2)18(4)20(17(15)3)33(31,32)26-12-10-25(11-13-26)19(28)8-7-9-27-21(29)23(5,6)24-22(27)30/h14H,7-13H2,1-6H3,(H,24,30) |
| InChIKey | WOHGQKGCCUVVGJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|