C22H35N5O4 — CID 55441904
3-[4-oxo-4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 55441904) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[4-oxo-4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[4-oxo-4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 55441904 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 3-[4-oxo-4-[4-(2-oxo-2-piperidin-1-ylethyl)piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)N1CCN(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C22H35N5O4/c28-18(7-6-12-27-20(30)22(23-21(27)31)8-2-3-9-22)26-15-13-24(14-16-26)17-19(29)25-10-4-1-5-11-25/h1-17H2,(H,23,31) |
| InChIKey | DHBGYDZPJOUQIB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|