C20H33N5O5 — CID 55429011
2-[4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 55429011) has the molecular formula C20H33N5O5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55429011 |
| Molecular Formula | C20H33N5O5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 2-[4-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)CCN2C(=O)NC3(CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C20H33N5O5/c1-30-14-4-8-21-16(26)15-23-10-12-24(13-11-23)17(27)5-9-25-18(28)20(22-19(25)29)6-2-3-7-20/h2-15H2,1H3,(H,21,26)(H,22,29) |
| InChIKey | SMDJNYFRNSEMEF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|