C21H35N5O5 — CID 55429013
N-(3-methoxypropyl)-2-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 55429013) has the molecular formula C21H35N5O5 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-methoxypropyl)-2-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55429013 |
| Molecular Formula | C21H35N5O5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-(3-methoxypropyl)-2-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C21H35N5O5/c1-23-20(30)26(19(29)21(23)7-4-3-5-8-21)16-18(28)25-12-10-24(11-13-25)15-17(27)22-9-6-14-31-2/h3-16H2,1-2H3,(H,22,27) |
| InChIKey | WIFCOMSOGPJCNS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|