C18H28N4O5 — CID 91639709
ethyl 4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazine-1-carboxylate (PubChem CID 91639709) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is ethyl 4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91639709 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | ethyl 4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C18H28N4O5/c1-3-27-17(26)21-11-9-20(10-12-21)14(23)13-22-15(24)18(19(2)16(22)25)7-5-4-6-8-18/h3-13H2,1-2H3 |
| InChIKey | DNEKSPJEQWBERV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|