C23H29N5O3 — CID 55716187
4-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]benzonitrile (PubChem CID 55716187) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 55716187 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 4-[4-[2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]-1,4-diazepan-1-yl]benzonitrile |
| SMILES | CN1C(=O)N(CC(=O)N2CCCN(c3ccc(C#N)cc3)CC2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C23H29N5O3/c1-25-22(31)28(21(30)23(25)10-3-2-4-11-23)17-20(29)27-13-5-12-26(14-15-27)19-8-6-18(16-24)7-9-19/h6-9H,2-5,10-15,17H2,1H3 |
| InChIKey | AWGZTNVDSCZZCX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|