C16H17N3O2 — CID 167840346
4-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile (PubChem CID 167840346) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile.
| Compound Name | 4-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile |
|---|---|
| PubChem CID | 167840346 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 4-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)benzonitrile |
| SMILES | CN1C(=O)N(c2ccc(C#N)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H17N3O2/c1-18-15(21)19(13-7-5-12(11-17)6-8-13)14(20)16(18)9-3-2-4-10-16/h5-8H,2-4,9-10H2,1H3 |
| InChIKey | DKCAVNAGQCVEKW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|