C15H12F3N3O3 — CID 146065705
4-[(5R)-1-methyl-2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 146065705) has the molecular formula C15H12F3N3O3 and a molecular weight of 339.27 g/mol. Its IUPAC name is 4-[(5R)-1-methyl-2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(5R)-1-methyl-2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 146065705 |
| Molecular Formula | C15H12F3N3O3 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[(5R)-1-methyl-2,4-dioxo-7-oxa-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CN1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)[C@]12CCOC2 |
| InChI | InChI=1S/C15H12F3N3O3/c1-20-13(23)21(12(22)14(20)4-5-24-8-14)10-3-2-9(7-19)11(6-10)15(16,17)18/h2-3,6H,4-5,8H2,1H3/t14-/m1/s1 |
| InChIKey | GKZWTTZXXUWMQZ-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|