C14H11BrF3N3OS — CID 102002891
4-[(4R)-4-(bromomethyl)-3,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 102002891) has the molecular formula C14H11BrF3N3OS and a molecular weight of 406.23 g/mol. Its IUPAC name is 4-[(4R)-4-(bromomethyl)-3,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4R)-4-(bromomethyl)-3,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 102002891 |
| Molecular Formula | C14H11BrF3N3OS |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 4-[(4R)-4-(bromomethyl)-3,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CN1C(=S)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)[C@]1(C)CBr |
| InChI | InChI=1S/C14H11BrF3N3OS/c1-13(7-15)11(22)21(12(23)20(13)2)9-4-3-8(6-19)10(5-9)14(16,17)18/h3-5H,7H2,1-2H3/t13-/m0/s1 |
| InChIKey | NAPCBXJEPRJJBM-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|