C25H34F3N5OS — CID 22562625
4-[4,4-dimethyl-3-[7-(4-methylpiperazin-1-yl)heptyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562625) has the molecular formula C25H34F3N5OS and a molecular weight of 509.64 g/mol. Its IUPAC name is 4-[4,4-dimethyl-3-[7-(4-methylpiperazin-1-yl)heptyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-3-[7-(4-methylpiperazin-1-yl)heptyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562625 |
| Molecular Formula | C25H34F3N5OS |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 4-[4,4-dimethyl-3-[7-(4-methylpiperazin-1-yl)heptyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CN1CCN(CCCCCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C25H34F3N5OS/c1-24(2)22(34)33(20-10-9-19(18-29)21(17-20)25(26,27)28)23(35)32(24)12-8-6-4-5-7-11-31-15-13-30(3)14-16-31/h9-10,17H,4-8,11-16H2,1-3H3 |
| InChIKey | VYANGKDJOXIKPX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|