C28H40F3N5O3S2 — CID 22562905
4-[4,4-dimethyl-5-oxo-3-[8-(4-propan-2-ylsulfonylpiperazin-1-yl)octyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562905) has the molecular formula C28H40F3N5O3S2 and a molecular weight of 615.79 g/mol. Its IUPAC name is 4-[4,4-dimethyl-5-oxo-3-[8-(4-propan-2-ylsulfonylpiperazin-1-yl)octyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4,4-dimethyl-5-oxo-3-[8-(4-propan-2-ylsulfonylpiperazin-1-yl)octyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562905 |
| Molecular Formula | C28H40F3N5O3S2 |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 4-[4,4-dimethyl-5-oxo-3-[8-(4-propan-2-ylsulfonylpiperazin-1-yl)octyl]-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(C)S(=O)(=O)N1CCN(CCCCCCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C28H40F3N5O3S2/c1-21(2)41(38,39)34-17-15-33(16-18-34)13-9-7-5-6-8-10-14-35-26(40)36(25(37)27(35,3)4)23-12-11-22(20-32)24(19-23)28(29,30)31/h11-12,19,21H,5-10,13-18H2,1-4H3 |
| InChIKey | PAPZSTUMZXFLDI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|