C23H28F3N5O2S2 — CID 87999114
4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butyl]-1,4-diazepane-1-carbothioic S-acid (PubChem CID 87999114) has the molecular formula C23H28F3N5O2S2 and a molecular weight of 527.64 g/mol. Its IUPAC name is 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butyl]-1,4-diazepane-1-carbothioic S-acid.
| Compound Name | 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butyl]-1,4-diazepane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 87999114 |
| Molecular Formula | C23H28F3N5O2S2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 4-[4-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butyl]-1,4-diazepane-1-carbothioic S-acid |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CCCCN1CCCN(C(=O)S)CC1 |
| InChI | InChI=1S/C23H28F3N5O2S2/c1-22(2)19(32)31(17-7-6-16(15-27)18(14-17)23(24,25)26)20(34)30(22)11-4-3-8-28-9-5-10-29(13-12-28)21(33)35/h6-7,14H,3-5,8-13H2,1-2H3,(H,33,35) |
| InChIKey | GDKALJXYZRCFTP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|