C28H32F3N5O3S — CID 22562638
4-[3-[5-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]pentyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562638) has the molecular formula C28H32F3N5O3S and a molecular weight of 575.66 g/mol. Its IUPAC name is 4-[3-[5-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]pentyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[5-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]pentyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562638 |
| Molecular Formula | C28H32F3N5O3S |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 4-[3-[5-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]pentyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CCCCCN1CCCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C28H32F3N5O3S/c1-27(2)25(38)36(21-10-9-20(19-32)22(18-21)28(29,30)31)26(40)35(27)14-5-3-4-11-33-12-7-13-34(16-15-33)24(37)23-8-6-17-39-23/h6,8-10,17-18H,3-5,7,11-16H2,1-2H3 |
| InChIKey | DSLOAUOYPXNZOA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|