C29H42F3N7O2S2 — CID 161344531
4-[4,4-dimethyl-3-[6-(4-methylpiperazin-1-yl)hexyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;piperazine-1-carbothioic S-acid (PubChem CID 161344531) has the molecular formula C29H42F3N7O2S2 and a molecular weight of 641.83 g/mol. Its IUPAC name is 4-[4,4-dimethyl-3-[6-(4-methylpiperazin-1-yl)hexyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;piperazine-1-carbothioic S-acid.
| Compound Name | 4-[4,4-dimethyl-3-[6-(4-methylpiperazin-1-yl)hexyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;piperazine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 161344531 |
| Molecular Formula | C29H42F3N7O2S2 |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 4-[4,4-dimethyl-3-[6-(4-methylpiperazin-1-yl)hexyl]-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile;piperazine-1-carbothioic S-acid |
| SMILES | CN1CCN(CCCCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)CC1.O=C(S)N1CCNCC1 |
| InChI | InChI=1S/C24H32F3N5OS.C5H10N2OS/c1-23(2)21(33)32(19-9-8-18(17-28)20(16-19)24(25,26)27)22(34)31(23)11-7-5-4-6-10-30-14-12-29(3)13-15-30;8-5(9)7-3-1-6-2-4-7/h8-9,16H,4-7,10-15H2,1-3H3;6H,1-4H2,(H,8,9) |
| InChIKey | VNCRKRAUBUWQLQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|