C25H31F3N6OS — CID 22563118
4-[7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]heptyl]piperazine-1-carbonitrile (PubChem CID 22563118) has the molecular formula C25H31F3N6OS and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-[7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]heptyl]piperazine-1-carbonitrile.
| Compound Name | 4-[7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]heptyl]piperazine-1-carbonitrile |
|---|---|
| PubChem CID | 22563118 |
| Molecular Formula | C25H31F3N6OS |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 4-[7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]heptyl]piperazine-1-carbonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CCCCCCCN1CCN(C#N)CC1 |
| InChI | InChI=1S/C25H31F3N6OS/c1-24(2)22(35)34(20-9-8-19(17-29)21(16-20)25(26,27)28)23(36)33(24)11-7-5-3-4-6-10-31-12-14-32(18-30)15-13-31/h8-9,16H,3-7,10-15H2,1-2H3 |
| InChIKey | FUGVUISSDGJOFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|