C28H29F3N6O3S2 — CID 22562809
4-[3-[4-[4-(4-cyanophenyl)sulfonylpiperazin-1-yl]butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562809) has the molecular formula C28H29F3N6O3S2 and a molecular weight of 618.71 g/mol. Its IUPAC name is 4-[3-[4-[4-(4-cyanophenyl)sulfonylpiperazin-1-yl]butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-[4-(4-cyanophenyl)sulfonylpiperazin-1-yl]butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562809 |
| Molecular Formula | C28H29F3N6O3S2 |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 4-[3-[4-[4-(4-cyanophenyl)sulfonylpiperazin-1-yl]butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CCCCN1CCN(S(=O)(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C28H29F3N6O3S2/c1-27(2)25(38)37(22-8-7-21(19-33)24(17-22)28(29,30)31)26(41)36(27)12-4-3-11-34-13-15-35(16-14-34)42(39,40)23-9-5-20(18-32)6-10-23/h5-10,17H,3-4,11-16H2,1-2H3 |
| InChIKey | TYZJIVVEOUUCBO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|