C24H30F3N5O2S — CID 11398102
(2R)-1-[6-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]hexyl]pyrrolidine-2-carboxamide (PubChem CID 11398102) has the molecular formula C24H30F3N5O2S and a molecular weight of 509.60 g/mol. Its IUPAC name is (2R)-1-[6-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]hexyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[6-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]hexyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11398102 |
| Molecular Formula | C24H30F3N5O2S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (2R)-1-[6-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]hexyl]pyrrolidine-2-carboxamide |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=S)N1CCCCCCN1CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C24H30F3N5O2S/c1-23(2)21(34)32(17-10-9-16(15-28)18(14-17)24(25,26)27)22(35)31(23)13-6-4-3-5-11-30-12-7-8-19(30)20(29)33/h9-10,14,19H,3-8,11-13H2,1-2H3,(H2,29,33)/t19-/m1/s1 |
| InChIKey | PWZISQFNADEVGX-LJQANCHMSA-N |
| XLogP | 3.80 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|