C25H32F3N5O2S — CID 22562536
4-[3-[4-(4-acetyl-2,5-dimethylpiperazin-1-yl)butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562536) has the molecular formula C25H32F3N5O2S and a molecular weight of 523.63 g/mol. Its IUPAC name is 4-[3-[4-(4-acetyl-2,5-dimethylpiperazin-1-yl)butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-(4-acetyl-2,5-dimethylpiperazin-1-yl)butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562536 |
| Molecular Formula | C25H32F3N5O2S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 4-[3-[4-(4-acetyl-2,5-dimethylpiperazin-1-yl)butyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(=O)N1CC(C)N(CCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)CC1C |
| InChI | InChI=1S/C25H32F3N5O2S/c1-16-15-31(18(3)34)17(2)14-30(16)10-6-7-11-32-23(36)33(22(35)24(32,4)5)20-9-8-19(13-29)21(12-20)25(26,27)28/h8-9,12,16-17H,6-7,10-11,14-15H2,1-5H3 |
| InChIKey | CRLZKUIGKUIHDC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|