C27H36F3N5O2S — CID 87999922
4-[3-[6-[(2R,6S)-4-acetyl-2,6-dimethylpiperazin-1-yl]hexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 87999922) has the molecular formula C27H36F3N5O2S and a molecular weight of 551.68 g/mol. Its IUPAC name is 4-[3-[6-[(2R,6S)-4-acetyl-2,6-dimethylpiperazin-1-yl]hexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[6-[(2R,6S)-4-acetyl-2,6-dimethylpiperazin-1-yl]hexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87999922 |
| Molecular Formula | C27H36F3N5O2S |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 4-[3-[6-[(2R,6S)-4-acetyl-2,6-dimethylpiperazin-1-yl]hexyl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(=O)N1C[C@@H](C)N(CCCCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C2(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C27H36F3N5O2S/c1-18-16-32(20(3)36)17-19(2)33(18)12-8-6-7-9-13-34-25(38)35(24(37)26(34,4)5)22-11-10-21(15-31)23(14-22)27(28,29)30/h10-11,14,18-19H,6-9,12-13,16-17H2,1-5H3/t18-,19+ |
| InChIKey | LXNVDKQMWMTVMV-KDURUIRLSA-N |
| XLogP | 4.79 |
| TPSA | 70.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|