C28H40F3N5OS — CID 22562723
4-[3-[7-(4-acetyl-2,6-dimethylpiperazin-1-yl)heptyl]-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 22562723) has the molecular formula C28H40F3N5OS and a molecular weight of 551.72 g/mol. Its IUPAC name is 4-[3-[7-(4-acetyl-2,6-dimethylpiperazin-1-yl)heptyl]-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[7-(4-acetyl-2,6-dimethylpiperazin-1-yl)heptyl]-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 22562723 |
| Molecular Formula | C28H40F3N5OS |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 4-[3-[7-(4-acetyl-2,6-dimethylpiperazin-1-yl)heptyl]-4,4-dimethyl-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(=O)N1CC(C)N(CCCCCCCN2C(=S)N(c3ccc(C#N)c(C(F)(F)F)c3)CC2(C)C)C(C)C1 |
| InChI | InChI=1S/C28H40F3N5OS/c1-20-17-33(22(3)37)18-21(2)34(20)13-9-7-6-8-10-14-36-26(38)35(19-27(36,4)5)24-12-11-23(16-32)25(15-24)28(29,30)31/h11-12,15,20-21H,6-10,13-14,17-19H2,1-5H3 |
| InChIKey | SADLVIMNDPDMDO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|