C24H33F3N4O3S2 — CID 11157043
9-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylnonane-1-sulfonamide (PubChem CID 11157043) has the molecular formula C24H33F3N4O3S2 and a molecular weight of 546.68 g/mol. Its IUPAC name is 9-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylnonane-1-sulfonamide.
| Compound Name | 9-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylnonane-1-sulfonamide |
|---|---|
| PubChem CID | 11157043 |
| Molecular Formula | C24H33F3N4O3S2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 9-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylnonane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCCCCCCCN1C(=S)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C24H33F3N4O3S2/c1-23(2)21(32)31(19-13-12-18(17-28)20(16-19)24(25,26)27)22(35)30(23)14-10-8-6-5-7-9-11-15-36(33,34)29(3)4/h12-13,16H,5-11,14-15H2,1-4H3 |
| InChIKey | RWAJOCIJOKQBGB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|