C22H29F3N4O3S2 — CID 11398247
7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylheptane-1-sulfonamide (PubChem CID 11398247) has the molecular formula C22H29F3N4O3S2 and a molecular weight of 518.63 g/mol. Its IUPAC name is 7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylheptane-1-sulfonamide.
| Compound Name | 7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylheptane-1-sulfonamide |
|---|---|
| PubChem CID | 11398247 |
| Molecular Formula | C22H29F3N4O3S2 |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 7-[3-[4-cyano-3-(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N,N-dimethylheptane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)CCCCCCCN1C(=S)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C22H29F3N4O3S2/c1-21(2)19(30)29(17-11-10-16(15-26)18(14-17)22(23,24)25)20(33)28(21)12-8-6-5-7-9-13-34(31,32)27(3)4/h10-11,14H,5-9,12-13H2,1-4H3 |
| InChIKey | RFADMXFMANTBLA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|