C22H15F3N4OS — CID 87606533
3-[1-(4-cyanophenyl)-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 87606533) has the molecular formula C22H15F3N4OS and a molecular weight of 440.45 g/mol. Its IUPAC name is 3-[1-(4-cyanophenyl)-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 3-[1-(4-cyanophenyl)-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 87606533 |
| Molecular Formula | C22H15F3N4OS |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 3-[1-(4-cyanophenyl)-4-oxo-2-sulfanylidene-1,3-diazaspiro[4.4]nonan-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=S)N(c3cccc(C#N)c3C(F)(F)F)C(=O)C23CCCC3)cc1 |
| InChI | InChI=1S/C22H15F3N4OS/c23-22(24,25)18-15(13-27)4-3-5-17(18)28-19(30)21(10-1-2-11-21)29(20(28)31)16-8-6-14(12-26)7-9-16/h3-9H,1-2,10-11H2 |
| InChIKey | KZCOCLWBKJWKGF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|