C19H13ClFN3OS — CID 86280562
2-chloro-4-[5-(4-fluorophenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]benzonitrile (PubChem CID 86280562) has the molecular formula C19H13ClFN3OS and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-chloro-4-[5-(4-fluorophenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]benzonitrile.
| Compound Name | 2-chloro-4-[5-(4-fluorophenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]benzonitrile |
|---|---|
| PubChem CID | 86280562 |
| Molecular Formula | C19H13ClFN3OS |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-chloro-4-[5-(4-fluorophenyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-7-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C3(CCC3)N(c3ccc(F)cc3)C2=S)cc1Cl |
| InChI | InChI=1S/C19H13ClFN3OS/c20-16-10-15(5-2-12(16)11-22)23-17(25)19(8-1-9-19)24(18(23)26)14-6-3-13(21)4-7-14/h2-7,10H,1,8-9H2 |
| InChIKey | SWHMHUOOJWHYJB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|