C12H10ClN3OS — CID 50915198
2-chloro-4-(4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile (PubChem CID 50915198) has the molecular formula C12H10ClN3OS and a molecular weight of 279.75 g/mol. Its IUPAC name is 2-chloro-4-(4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile.
| Compound Name | 2-chloro-4-(4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 50915198 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-chloro-4-(4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile |
| SMILES | CC1(C)NC(=S)N(c2ccc(C#N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C12H10ClN3OS/c1-12(2)10(17)16(11(18)15-12)8-4-3-7(6-14)9(13)5-8/h3-5H,1-2H3,(H,15,18) |
| InChIKey | XYXGOXZJXGSUFQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|