C12H7ClN2O2 — CID 43237080
2-chloro-4-(3-methyl-2,5-dioxopyrrol-1-yl)benzonitrile (PubChem CID 43237080) has the molecular formula C12H7ClN2O2 and a molecular weight of 246.65 g/mol. Its IUPAC name is 2-chloro-4-(3-methyl-2,5-dioxopyrrol-1-yl)benzonitrile.
| Compound Name | 2-chloro-4-(3-methyl-2,5-dioxopyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 43237080 |
| Molecular Formula | C12H7ClN2O2 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-chloro-4-(3-methyl-2,5-dioxopyrrol-1-yl)benzonitrile |
| SMILES | CC1=CC(=O)N(c2ccc(C#N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C12H7ClN2O2/c1-7-4-11(16)15(12(7)17)9-3-2-8(6-14)10(13)5-9/h2-5H,1H3 |
| InChIKey | AJMNPOIIXCQQIR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|