C15H21ClN2O2 — CID 143759878
2-chloro-4-[(4R)-4-methyl-2-oxopyrrolidin-1-yl]benzonitrile;ethane;methanol (PubChem CID 143759878) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-4-[(4R)-4-methyl-2-oxopyrrolidin-1-yl]benzonitrile;ethane;methanol.
| Compound Name | 2-chloro-4-[(4R)-4-methyl-2-oxopyrrolidin-1-yl]benzonitrile;ethane;methanol |
|---|---|
| PubChem CID | 143759878 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-chloro-4-[(4R)-4-methyl-2-oxopyrrolidin-1-yl]benzonitrile;ethane;methanol |
| SMILES | CC.CO.C[C@@H]1CC(=O)N(c2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H11ClN2O.C2H6.CH4O/c1-8-4-12(16)15(7-8)10-3-2-9(6-14)11(13)5-10;2*1-2/h2-3,5,8H,4,7H2,1H3;1-2H3;2H,1H3/t8-;;/m1../s1 |
| InChIKey | UCZALAACCAOUBG-YCBDHFTFSA-N |
| XLogP | 3.22 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |