C11H9ClN2O — CID 53416774
2-chloro-4-(2-oxopyrrolidin-1-yl)benzonitrile (PubChem CID 53416774) has the molecular formula C11H9ClN2O and a molecular weight of 220.66 g/mol. Its IUPAC name is 2-chloro-4-(2-oxopyrrolidin-1-yl)benzonitrile.
| Compound Name | 2-chloro-4-(2-oxopyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 53416774 |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2-chloro-4-(2-oxopyrrolidin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCC2=O)cc1Cl |
| InChI | InChI=1S/C11H9ClN2O/c12-10-6-9(4-3-8(10)7-13)14-5-1-2-11(14)15/h3-4,6H,1-2,5H2 |
| InChIKey | YNGGZUVWPSTLIC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |