C12H8NO4- — CID 26580205
4-(3-methyl-2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 26580205) has the molecular formula C12H8NO4- and a molecular weight of 230.20 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 26580205 |
| Molecular Formula | C12H8NO4- |
| Molecular Weight | 230.20 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-(3-methyl-2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | CC1=CC(=O)N(c2ccc(C(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C12H9NO4/c1-7-6-10(14)13(11(7)15)9-4-2-8(3-5-9)12(16)17/h2-6H,1H3,(H,16,17)/p-1 |
| InChIKey | KMCMXICWYKCOCL-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|