C19H25NO3 — CID 21321064
1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylpyrrole-2,5-dione (PubChem CID 21321064) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 21321064 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C1=O |
| InChI | InChI=1S/C19H25NO3/c1-11-8-15(21)20(17(11)23)12-9-13(18(2,3)4)16(22)14(10-12)19(5,6)7/h8-10,22H,1-7H3 |
| InChIKey | ULWZGEPQFUGQJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|