C13H7NO5 — CID 88791034
1-(1,3-dioxo-2-benzofuran-5-yl)-3-methylpyrrole-2,5-dione (PubChem CID 88791034) has the molecular formula C13H7NO5 and a molecular weight of 257.20 g/mol. Its IUPAC name is 1-(1,3-dioxo-2-benzofuran-5-yl)-3-methylpyrrole-2,5-dione.
| Compound Name | 1-(1,3-dioxo-2-benzofuran-5-yl)-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 88791034 |
| Molecular Formula | C13H7NO5 |
| Molecular Weight | 257.20 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-(1,3-dioxo-2-benzofuran-5-yl)-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2ccc3c(c2)C(=O)OC3=O)C1=O |
| InChI | InChI=1S/C13H7NO5/c1-6-4-10(15)14(11(6)16)7-2-3-8-9(5-7)13(18)19-12(8)17/h2-5H,1H3 |
| InChIKey | SFTBZVCNGHKBHA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|