C37H30N2O6 — CID 158317296
3-methyl-1-[4-[4-[3-[4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propyl]phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 158317296) has the molecular formula C37H30N2O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is 3-methyl-1-[4-[4-[3-[4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propyl]phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-[4-[4-[3-[4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propyl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158317296 |
| Molecular Formula | C37H30N2O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 3-methyl-1-[4-[4-[3-[4-[4-(3-methyl-2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propyl]phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2ccc(Oc3ccc(CCCc4ccc(Oc5ccc(N6C(=O)C=C(C)C6=O)cc5)cc4)cc3)cc2)C1=O |
| InChI | InChI=1S/C37H30N2O6/c1-24-22-34(40)38(36(24)42)28-10-18-32(19-11-28)44-30-14-6-26(7-15-30)4-3-5-27-8-16-31(17-9-27)45-33-20-12-29(13-21-33)39-35(41)23-25(2)37(39)43/h6-23H,3-5H2,1-2H3 |
| InChIKey | GOKKYKQAJYTEJH-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|