C12H15N3OS — CID 22949183
3-(2,6-dimethyl-4-pyridinyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 22949183) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-(2,6-dimethyl-4-pyridinyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 3-(2,6-dimethyl-4-pyridinyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 22949183 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-(2,6-dimethyl-4-pyridinyl)-5,5-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cc(N2C(=O)C(C)(C)NC2=S)cc(C)n1 |
| InChI | InChI=1S/C12H15N3OS/c1-7-5-9(6-8(2)13-7)15-10(16)12(3,4)14-11(15)17/h5-6H,1-4H3,(H,14,17) |
| InChIKey | ULLYGMHAKKNOEH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|