C16H16N4O3 — CID 146289812
5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione (PubChem CID 146289812) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146289812 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2cc(N3C(=O)NC(C)(C)C3=O)ncn2)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-4-6-11(7-5-10)23-13-8-12(17-9-18-13)20-14(21)16(2,3)19-15(20)22/h4-9H,1-3H3,(H,19,22) |
| InChIKey | XYWKUZMBAZJAMY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|