About 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione
5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione (PubChem CID 146289812) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione |
| PubChem CID | 146289812 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(Oc2cc(N3C(=O)NC(C)(C)C3=O)ncn2)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-4-6-11(7-5-10)23-13-8-12(17-9-18-13)20-14(21)16(2,3)19-15(20)22/h4-9H,1-3H3,(H,19,22) |
| InChIKey | XYWKUZMBAZJAMY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione?
The IUPAC name of 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione (CID 146289812) is 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione?
The canonical SMILES for 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione is Cc1ccc(Oc2cc(N3C(=O)NC(C)(C)C3=O)ncn2)cc1.
What is the InChIKey of 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione?
The InChIKey is XYWKUZMBAZJAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-10-4-6-11(7-5-10)23-13-8-12(17-9-18-13)20-14(21)16(2,3)19-15(20)22/h4-9H,1-3H3,(H,19,22).
What are the key properties of 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione?
5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione has a molecular weight of 312.33 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3-[6-(4-methylphenoxy)pyrimidin-4-yl]imidazolidine-2,4-dione is sourced from PubChem (CID 146289812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).