C17H18N4O4 — CID 146289862
3-[6-(4-methoxy-3-methylphenoxy)pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 146289862) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 3-[6-(4-methoxy-3-methylphenoxy)pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[6-(4-methoxy-3-methylphenoxy)pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146289862 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[6-(4-methoxy-3-methylphenoxy)pyrimidin-4-yl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccc(Oc2cc(N3C(=O)NC(C)(C)C3=O)ncn2)cc1C |
| InChI | InChI=1S/C17H18N4O4/c1-10-7-11(5-6-12(10)24-4)25-14-8-13(18-9-19-14)21-15(22)17(2,3)20-16(21)23/h5-9H,1-4H3,(H,20,23) |
| InChIKey | RAOSZBXJJDPLDI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|