C19H17N3O4 — CID 53241215
4-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenoxy]-2-methoxybenzonitrile (PubChem CID 53241215) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenoxy]-2-methoxybenzonitrile.
| Compound Name | 4-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenoxy]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 53241215 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-[4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)phenoxy]-2-methoxybenzonitrile |
| SMILES | COc1cc(Oc2ccc(N3C(=O)NC(C)(C)C3=O)cc2)ccc1C#N |
| InChI | InChI=1S/C19H17N3O4/c1-19(2)17(23)22(18(24)21-19)13-5-8-14(9-6-13)26-15-7-4-12(11-20)16(10-15)25-3/h4-10H,1-3H3,(H,21,24) |
| InChIKey | PHHFRGHBRKBAKY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|