C18H16N4O3 — CID 129216936
2-[[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]oxy]-3-methylbenzonitrile (PubChem CID 129216936) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]oxy]-3-methylbenzonitrile.
| Compound Name | 2-[[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]oxy]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 129216936 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[[5-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-pyridinyl]oxy]-3-methylbenzonitrile |
| SMILES | Cc1cccc(C#N)c1Oc1ccc(N2C(=O)NC(C)(C)C2=O)cn1 |
| InChI | InChI=1S/C18H16N4O3/c1-11-5-4-6-12(9-19)15(11)25-14-8-7-13(10-20-14)22-16(23)18(2,3)21-17(22)24/h4-8,10H,1-3H3,(H,21,24) |
| InChIKey | QMGVTQHMDSHRNN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|