C20H21N3O4 — CID 118945967
3-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 118945967) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118945967 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[6-[(3,3-dimethyl-1H-2-benzofuran-5-yl)oxy]-3-pyridinyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc(Oc3ccc4c(c3)C(C)(C)OC4)nc2)C1=O |
| InChI | InChI=1S/C20H21N3O4/c1-19(2)17(24)23(18(25)22-19)13-6-8-16(21-10-13)27-14-7-5-12-11-26-20(3,4)15(12)9-14/h5-10H,11H2,1-4H3,(H,22,25) |
| InChIKey | GMXHBQCTYIYGAG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|